C30H43N7O6 — CID 123799852
(4,5-dimethyl-9-oxo-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl) N-[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-ethylcarbamate (PubChem CID 123799852) has the molecular formula C30H43N7O6 and a molecular weight of 597.72 g/mol. Its IUPAC name is (4,5-dimethyl-9-oxo-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl) N-[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-ethylcarbamate.
| Compound Name | (4,5-dimethyl-9-oxo-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl) N-[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 123799852 |
| Molecular Formula | C30H43N7O6 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | (4,5-dimethyl-9-oxo-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl) N-[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCNC(=O)C(CCCN=C(N)N)NC(C)=O)C(=O)Oc1ccc2c3c1OC1C(=O)CCC4C(C)N(C)C2CC314 |
| InChI | InChI=1S/C30H43N7O6/c1-5-37(14-13-33-27(40)20(35-17(3)38)7-6-12-34-28(31)32)29(41)42-23-11-8-18-21-15-30-19(16(2)36(21)4)9-10-22(39)26(30)43-25(23)24(18)30/h8,11,16,19-21,26H,5-7,9-10,12-15H2,1-4H3,(H,33,40)(H,35,38)(H4,31,32,34) |
| InChIKey | NSODWYQDYYNAOU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 181.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|