C8H18N3O4S2+ — CID 123800748
N-[[1,4-bis(methylsulfonyl)piperazin-1-ium-1-yl]methyl]methanimine (PubChem CID 123800748) has the molecular formula C8H18N3O4S2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[[1,4-bis(methylsulfonyl)piperazin-1-ium-1-yl]methyl]methanimine.
| Compound Name | N-[[1,4-bis(methylsulfonyl)piperazin-1-ium-1-yl]methyl]methanimine |
|---|---|
| PubChem CID | 123800748 |
| Molecular Formula | C8H18N3O4S2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-[[1,4-bis(methylsulfonyl)piperazin-1-ium-1-yl]methyl]methanimine |
| SMILES | C=NC[N+]1(S(C)(=O)=O)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C8H18N3O4S2/c1-9-8-11(17(3,14)15)6-4-10(5-7-11)16(2,12)13/h1,4-8H2,2-3H3/q+1 |
| InChIKey | MOMKLQKMRAMMBF-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|