C17H31O5P2+ — CID 123803002
[hydroxy(4,8,12-trimethyltrideca-1,7,11-trienyl)phosphoryl]oxy-methoxy-oxophosphanium (PubChem CID 123803002) has the molecular formula C17H31O5P2+ and a molecular weight of 377.38 g/mol. Its IUPAC name is [hydroxy(4,8,12-trimethyltrideca-1,7,11-trienyl)phosphoryl]oxy-methoxy-oxophosphanium.
| Compound Name | [hydroxy(4,8,12-trimethyltrideca-1,7,11-trienyl)phosphoryl]oxy-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 123803002 |
| Molecular Formula | C17H31O5P2+ |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [hydroxy(4,8,12-trimethyltrideca-1,7,11-trienyl)phosphoryl]oxy-methoxy-oxophosphanium |
| SMILES | CO[P+](=O)OP(=O)(O)C=CCC(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C17H30O5P2/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-24(19,20)22-23(18)21-5/h8-9,11,14,17H,6-7,10,12-13H2,1-5H3/p+1 |
| InChIKey | HZAJMCVLYDMUQV-UHFFFAOYSA-O |
| XLogP | 6.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|