C21H22F2O3 — CID 123803423
butyl 3-(2,4-difluoro-3-phenylmethoxyphenyl)-2-methylprop-2-enoate (PubChem CID 123803423) has the molecular formula C21H22F2O3 and a molecular weight of 360.40 g/mol. Its IUPAC name is butyl 3-(2,4-difluoro-3-phenylmethoxyphenyl)-2-methylprop-2-enoate.
| Compound Name | butyl 3-(2,4-difluoro-3-phenylmethoxyphenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123803423 |
| Molecular Formula | C21H22F2O3 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | butyl 3-(2,4-difluoro-3-phenylmethoxyphenyl)-2-methylprop-2-enoate |
| SMILES | CCCCOC(=O)C(C)=Cc1ccc(F)c(OCc2ccccc2)c1F |
| InChI | InChI=1S/C21H22F2O3/c1-3-4-12-25-21(24)15(2)13-17-10-11-18(22)20(19(17)23)26-14-16-8-6-5-7-9-16/h5-11,13H,3-4,12,14H2,1-2H3 |
| InChIKey | RNTYMCBQVDVJSM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|