About 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate
2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate (PubChem CID 139677366) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate |
| PubChem CID | 139677366 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate |
| SMILES | C=Cc1ccccc1/C=C(\C)C(=O)OCCN |
| InChI | InChI=1S/C14H17NO2/c1-3-12-6-4-5-7-13(12)10-11(2)14(16)17-9-8-15/h3-7,10H,1,8-9,15H2,2H3/b11-10+ |
| InChIKey | NCTXJLOWCMBZLK-ZHACJKMWSA-N |
| XLogP | 2.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate?
The IUPAC name of 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate (CID 139677366) is 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate.
What is the SMILES notation for 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate?
The canonical SMILES for 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate is C=Cc1ccccc1/C=C(\C)C(=O)OCCN.
What is the InChIKey of 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate?
The InChIKey is NCTXJLOWCMBZLK-ZHACJKMWSA-N. The full InChI is InChI=1S/C14H17NO2/c1-3-12-6-4-5-7-13(12)10-11(2)14(16)17-9-8-15/h3-7,10H,1,8-9,15H2,2H3/b11-10+.
What are the key properties of 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate?
2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate has a molecular weight of 231.29 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl (E)-3-(2-ethenylphenyl)-2-methylprop-2-enoate is sourced from PubChem (CID 139677366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).