C9H14O3Si — CID 123804126
2-(silylmethoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 123804126) has the molecular formula C9H14O3Si and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(silylmethoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | 2-(silylmethoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 123804126 |
| Molecular Formula | C9H14O3Si |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-(silylmethoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1OC2C3CC(CC13)C2OC[SiH3] |
| InChI | InChI=1S/C9H14O3Si/c10-9-6-2-4-1-5(6)8(12-9)7(4)11-3-13/h4-8H,1-3H2,13H3 |
| InChIKey | HKCFZFBXCGHSOR-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|