C12H13F2O6- — CID 162450997
2,2-difluoro-2-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]acetate (PubChem CID 162450997) has the molecular formula C12H13F2O6- and a molecular weight of 291.23 g/mol. Its IUPAC name is 2,2-difluoro-2-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]acetate.
| Compound Name | 2,2-difluoro-2-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]acetate |
|---|---|
| PubChem CID | 162450997 |
| Molecular Formula | C12H13F2O6- |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,2-difluoro-2-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]acetate |
| SMILES | O=C1OC2C3CC(CC13)C2OCCOC(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C12H14F2O6/c13-12(14,11(16)17)19-2-1-18-8-5-3-6-7(4-5)10(15)20-9(6)8/h5-9H,1-4H2,(H,16,17)/p-1 |
| InChIKey | QPSXBBMYDVDYRB-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|