C9H13NO4 — CID 163430349
N-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]methanamine oxide (PubChem CID 163430349) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is N-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]methanamine oxide.
| Compound Name | N-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]methanamine oxide |
|---|---|
| PubChem CID | 163430349 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]methanamine oxide |
| SMILES | C[NH+]([O-])OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C9H13NO4/c1-10(12)14-7-4-2-5-6(3-4)9(11)13-8(5)7/h4-8,10H,2-3H2,1H3 |
| InChIKey | APYDGNRIEBDMBE-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|