C20H17F2N3O — CID 123806030
4-[2-(3,4-difluorophenyl)-5-ethoxy-3-pyridinyl]-2-methanimidoylaniline (PubChem CID 123806030) has the molecular formula C20H17F2N3O and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)-5-ethoxy-3-pyridinyl]-2-methanimidoylaniline.
| Compound Name | 4-[2-(3,4-difluorophenyl)-5-ethoxy-3-pyridinyl]-2-methanimidoylaniline |
|---|---|
| PubChem CID | 123806030 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)-5-ethoxy-3-pyridinyl]-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(-c2cc(OCC)cnc2-c2ccc(F)c(F)c2)ccc1N |
| InChI | InChI=1S/C20H17F2N3O/c1-2-26-15-9-16(12-4-6-19(24)14(7-12)10-23)20(25-11-15)13-3-5-17(21)18(22)8-13/h3-11,23H,2,24H2,1H3/b23-10+ |
| InChIKey | ZENYAASMTSSYLE-AUEPDCJTSA-N |
| XLogP | 4.67 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|