C25H24N4O3S — CID 123807045
2-[2-[(but-2-ynoylamino)methyl]pyrrolidin-1-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 123807045) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-[2-[(but-2-ynoylamino)methyl]pyrrolidin-1-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-[(but-2-ynoylamino)methyl]pyrrolidin-1-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123807045 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[2-[(but-2-ynoylamino)methyl]pyrrolidin-1-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC#CC(=O)NCC1CCCN1c1nc(-c2ccc(Oc3ccccc3)cc2)c(C(N)=O)s1 |
| InChI | InChI=1S/C25H24N4O3S/c1-2-7-21(30)27-16-18-8-6-15-29(18)25-28-22(23(33-25)24(26)31)17-11-13-20(14-12-17)32-19-9-4-3-5-10-19/h3-5,9-14,18H,6,8,15-16H2,1H3,(H2,26,31)(H,27,30) |
| InChIKey | XORZTHRVENPVPF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|