C25H23N5O3S — CID 90443255
2-(4-but-2-ynoylpiperazin-1-yl)-4-[3-(phenylcarbamoyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 90443255) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is 2-(4-but-2-ynoylpiperazin-1-yl)-4-[3-(phenylcarbamoyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-but-2-ynoylpiperazin-1-yl)-4-[3-(phenylcarbamoyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90443255 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-(4-but-2-ynoylpiperazin-1-yl)-4-[3-(phenylcarbamoyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | CC#CC(=O)N1CCN(c2nc(-c3cccc(C(=O)Nc4ccccc4)c3)c(C(N)=O)s2)CC1 |
| InChI | InChI=1S/C25H23N5O3S/c1-2-7-20(31)29-12-14-30(15-13-29)25-28-21(22(34-25)23(26)32)17-8-6-9-18(16-17)24(33)27-19-10-4-3-5-11-19/h3-6,8-11,16H,12-15H2,1H3,(H2,26,32)(H,27,33) |
| InChIKey | BRJHBECQGMZQNG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|