C26H26N4O3S — CID 134293284
2-[(1R,5S)-8-(1-hydroxybut-2-ynyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 134293284) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-[(1R,5S)-8-(1-hydroxybut-2-ynyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(1R,5S)-8-(1-hydroxybut-2-ynyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 134293284 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[(1R,5S)-8-(1-hydroxybut-2-ynyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-4-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC#CC(O)N1[C@@H]2CC[C@H]1CN(c1nc(-c3ccc(Oc4ccccc4)cc3)c(C(N)=O)s1)C2 |
| InChI | InChI=1S/C26H26N4O3S/c1-2-6-22(31)30-18-11-12-19(30)16-29(15-18)26-28-23(24(34-26)25(27)32)17-9-13-21(14-10-17)33-20-7-4-3-5-8-20/h3-5,7-10,13-14,18-19,22,31H,11-12,15-16H2,1H3,(H2,27,32)/t18-,19+,22? |
| InChIKey | JMDFJFLLMHDJEF-QIDMFYOTSA-N |
| XLogP | 3.70 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|