C25H24N4O3S — CID 85473211
4-(4-phenoxyphenyl)-2-[(1R,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-1,3-thiazole-5-carboxamide (PubChem CID 85473211) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 4-(4-phenoxyphenyl)-2-[(1R,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(4-phenoxyphenyl)-2-[(1R,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 85473211 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-(4-phenoxyphenyl)-2-[(1R,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1[C@@H]2CC[C@@H]1CN(c1nc(-c3ccc(Oc4ccccc4)cc3)c(C(N)=O)s1)C2 |
| InChI | InChI=1S/C25H24N4O3S/c1-2-21(30)29-17-10-11-18(29)15-28(14-17)25-27-22(23(33-25)24(26)31)16-8-12-20(13-9-16)32-19-6-4-3-5-7-19/h2-9,12-13,17-18H,1,10-11,14-15H2,(H2,26,31)/t17-,18-/m1/s1 |
| InChIKey | BODIQTYTOZEGLQ-QZTJIDSGSA-N |
| XLogP | 4.07 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|