C22H23BrClFN4O5 — CID 123807937
methyl 2-[7-bromo-3-chloro-1-fluoro-5-[methyl-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]chromeno[2,3-c]pyridin-5-yl]acetate (PubChem CID 123807937) has the molecular formula C22H23BrClFN4O5 and a molecular weight of 557.80 g/mol. Its IUPAC name is methyl 2-[7-bromo-3-chloro-1-fluoro-5-[methyl-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]chromeno[2,3-c]pyridin-5-yl]acetate.
| Compound Name | methyl 2-[7-bromo-3-chloro-1-fluoro-5-[methyl-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]chromeno[2,3-c]pyridin-5-yl]acetate |
|---|---|
| PubChem CID | 123807937 |
| Molecular Formula | C22H23BrClFN4O5 |
| Molecular Weight | 557.80 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | methyl 2-[7-bromo-3-chloro-1-fluoro-5-[methyl-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]chromeno[2,3-c]pyridin-5-yl]acetate |
| SMILES | COC(=O)CC1(N(C)C(N)=NC(=O)OC(C)(C)C)c2cc(Br)ccc2Oc2c1cc(Cl)nc2F |
| InChI | InChI=1S/C22H23BrClFN4O5/c1-21(2,3)34-20(31)28-19(26)29(4)22(10-16(30)32-5)12-8-11(23)6-7-14(12)33-17-13(22)9-15(24)27-18(17)25/h6-9H,10H2,1-5H3,(H2,26,28,31) |
| InChIKey | MRJKWCHVTPCUIO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|