C22H22N2O — CID 123810534
2-[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]phenyl]acetaldehyde (PubChem CID 123810534) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]phenyl]acetaldehyde.
| Compound Name | 2-[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 123810534 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]phenyl]acetaldehyde |
| SMILES | O=CCc1ccc(C(=CC2CCCC2)c2cc3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C22H22N2O/c25-13-11-16-7-9-18(10-8-16)20(14-17-4-1-2-5-17)21-15-19-6-3-12-23-22(19)24-21/h3,6-10,12-15,17H,1-2,4-5,11H2,(H,23,24) |
| InChIKey | AJFZULGHNIBMBA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|