C22H25N3 — CID 67227939
4-[(Z)-2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 67227939) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[(Z)-2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 67227939 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[(Z)-2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C(=C/C2CCCC2)c2cc3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C22H25N3/c1-25(2)19-11-9-17(10-12-19)20(14-16-6-3-4-7-16)21-15-18-8-5-13-23-22(18)24-21/h5,8-16H,3-4,6-7H2,1-2H3,(H,23,24)/b20-14- |
| InChIKey | CXCZXSDPLWBRBC-ZHZULCJRSA-N |
| XLogP | 5.25 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|