C20H27N3O5 — CID 123811502
N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 123811502) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 123811502 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | CC1(C)COC(CCCC=NNC(=O)c2ccc(C=CC(=O)NO)cc2)OC1 |
| InChI | InChI=1S/C20H27N3O5/c1-20(2)13-27-18(28-14-20)5-3-4-12-21-22-19(25)16-9-6-15(7-10-16)8-11-17(24)23-26/h6-12,18,26H,3-5,13-14H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | PODLBERYCYUVFQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|