C21H31N5O — CID 123812796
4-(methylideneamino)-3-[[3-methyl-4-(4-methylpiperazin-1-yl)anilino]methyliminomethyl]hex-3-en-2-one (PubChem CID 123812796) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-(methylideneamino)-3-[[3-methyl-4-(4-methylpiperazin-1-yl)anilino]methyliminomethyl]hex-3-en-2-one.
| Compound Name | 4-(methylideneamino)-3-[[3-methyl-4-(4-methylpiperazin-1-yl)anilino]methyliminomethyl]hex-3-en-2-one |
|---|---|
| PubChem CID | 123812796 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 4-(methylideneamino)-3-[[3-methyl-4-(4-methylpiperazin-1-yl)anilino]methyliminomethyl]hex-3-en-2-one |
| SMILES | C=NC(CC)=C(C=NCNc1ccc(N2CCN(C)CC2)c(C)c1)C(C)=O |
| InChI | InChI=1S/C21H31N5O/c1-6-20(22-4)19(17(3)27)14-23-15-24-18-7-8-21(16(2)13-18)26-11-9-25(5)10-12-26/h7-8,13-14,24H,4,6,9-12,15H2,1-3,5H3 |
| InChIKey | KSBQBIDPFOEOAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|