C10H19N3O4S — CID 123816295
3-(4-propan-2-yltriazol-1-yl)pentyl hydrogen sulfate (PubChem CID 123816295) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-(4-propan-2-yltriazol-1-yl)pentyl hydrogen sulfate.
| Compound Name | 3-(4-propan-2-yltriazol-1-yl)pentyl hydrogen sulfate |
|---|---|
| PubChem CID | 123816295 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-(4-propan-2-yltriazol-1-yl)pentyl hydrogen sulfate |
| SMILES | CCC(CCOS(=O)(=O)O)n1cc(C(C)C)nn1 |
| InChI | InChI=1S/C10H19N3O4S/c1-4-9(5-6-17-18(14,15)16)13-7-10(8(2)3)11-12-13/h7-9H,4-6H2,1-3H3,(H,14,15,16) |
| InChIKey | IFPSTGHUJNWDCJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|