C13H19F2NO3 — CID 123820107
7-(5-ethenyl-3,3-difluoro-2-oxopyrrolidin-1-yl)heptanoic acid (PubChem CID 123820107) has the molecular formula C13H19F2NO3 and a molecular weight of 275.29 g/mol. Its IUPAC name is 7-(5-ethenyl-3,3-difluoro-2-oxopyrrolidin-1-yl)heptanoic acid.
| Compound Name | 7-(5-ethenyl-3,3-difluoro-2-oxopyrrolidin-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 123820107 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 7-(5-ethenyl-3,3-difluoro-2-oxopyrrolidin-1-yl)heptanoic acid |
| SMILES | C=CC1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C13H19F2NO3/c1-2-10-9-13(14,15)12(19)16(10)8-6-4-3-5-7-11(17)18/h2,10H,1,3-9H2,(H,17,18) |
| InChIKey | XEKPLGHHHOTYAG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|