C22H33F2NO3 — CID 142838462
7-[2-[(1E,6Z,8Z)-4,4-difluoroundeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 142838462) has the molecular formula C22H33F2NO3 and a molecular weight of 397.51 g/mol. Its IUPAC name is 7-[2-[(1E,6Z,8Z)-4,4-difluoroundeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[2-[(1E,6Z,8Z)-4,4-difluoroundeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 142838462 |
| Molecular Formula | C22H33F2NO3 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 7-[2-[(1E,6Z,8Z)-4,4-difluoroundeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CC/C=C\C=C/CC(F)(F)C/C=C/C1CCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H33F2NO3/c1-2-3-4-6-9-16-22(23,24)17-11-12-19-14-15-20(26)25(19)18-10-7-5-8-13-21(27)28/h3-4,6,9,11-12,19H,2,5,7-8,10,13-18H2,1H3,(H,27,28)/b4-3-,9-6-,12-11+ |
| InChIKey | QXMJKZUITWWLOI-SRMINIDPSA-N |
| XLogP | 5.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|