C35H41ClN2O5S — CID 123820251
N-[3-[(4-chlorophenyl)methyl-[2,6-dimethyl-5-[3-(oxolan-3-ylmethoxy)phenoxy]hepta-2,4,6-trienyl]amino]-2-methylphenyl]methanesulfonamide (PubChem CID 123820251) has the molecular formula C35H41ClN2O5S and a molecular weight of 637.24 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)methyl-[2,6-dimethyl-5-[3-(oxolan-3-ylmethoxy)phenoxy]hepta-2,4,6-trienyl]amino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[3-[(4-chlorophenyl)methyl-[2,6-dimethyl-5-[3-(oxolan-3-ylmethoxy)phenoxy]hepta-2,4,6-trienyl]amino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 123820251 |
| Molecular Formula | C35H41ClN2O5S |
| Molecular Weight | 637.24 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | N-[3-[(4-chlorophenyl)methyl-[2,6-dimethyl-5-[3-(oxolan-3-ylmethoxy)phenoxy]hepta-2,4,6-trienyl]amino]-2-methylphenyl]methanesulfonamide |
| SMILES | C=C(C)C(=CC=C(C)CN(Cc1ccc(Cl)cc1)c1cccc(NS(C)(=O)=O)c1C)Oc1cccc(OCC2CCOC2)c1 |
| InChI | InChI=1S/C35H41ClN2O5S/c1-25(2)35(43-32-9-6-8-31(20-32)42-24-29-18-19-41-23-29)17-12-26(3)21-38(22-28-13-15-30(36)16-14-28)34-11-7-10-33(27(34)4)37-44(5,39)40/h6-17,20,29,37H,1,18-19,21-24H2,2-5H3 |
| InChIKey | YLIDPGSSNCPPMC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.24 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|