C14H24N4O4 — CID 123821826
2-[(1-cyano-1,3-dimethoxybutyl)diazenyl]-2,4-dimethoxypentanenitrile (PubChem CID 123821826) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[(1-cyano-1,3-dimethoxybutyl)diazenyl]-2,4-dimethoxypentanenitrile.
| Compound Name | 2-[(1-cyano-1,3-dimethoxybutyl)diazenyl]-2,4-dimethoxypentanenitrile |
|---|---|
| PubChem CID | 123821826 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[(1-cyano-1,3-dimethoxybutyl)diazenyl]-2,4-dimethoxypentanenitrile |
| SMILES | COC(C)CC(C#N)(N=NC(C#N)(CC(C)OC)OC)OC |
| InChI | InChI=1S/C14H24N4O4/c1-11(19-3)7-13(9-15,21-5)17-18-14(10-16,22-6)8-12(2)20-4/h11-12H,7-8H2,1-6H3 |
| InChIKey | OWEXCRDQIAXYGT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|