C12H18N4O2 — CID 142205651
2-(2-cyanobutan-2-yldiazenyl)-4-methoxy-2-methyl-5-oxopentanenitrile (PubChem CID 142205651) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(2-cyanobutan-2-yldiazenyl)-4-methoxy-2-methyl-5-oxopentanenitrile.
| Compound Name | 2-(2-cyanobutan-2-yldiazenyl)-4-methoxy-2-methyl-5-oxopentanenitrile |
|---|---|
| PubChem CID | 142205651 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(2-cyanobutan-2-yldiazenyl)-4-methoxy-2-methyl-5-oxopentanenitrile |
| SMILES | CCC(C)(C#N)/N=N/C(C)(C#N)CC(C=O)OC |
| InChI | InChI=1S/C12H18N4O2/c1-5-11(2,8-13)15-16-12(3,9-14)6-10(7-17)18-4/h7,10H,5-6H2,1-4H3/b16-15+ |
| InChIKey | JDCLYYRXZQZKAY-FOCLMDBBSA-N |
| XLogP | 2.02 |
| TPSA | 98.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|