C10H16N4 — CID 139813830
2-(2-cyanobutan-2-yldiazenyl)pentanenitrile (PubChem CID 139813830) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2-(2-cyanobutan-2-yldiazenyl)pentanenitrile.
| Compound Name | 2-(2-cyanobutan-2-yldiazenyl)pentanenitrile |
|---|---|
| PubChem CID | 139813830 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-(2-cyanobutan-2-yldiazenyl)pentanenitrile |
| SMILES | CCCC(C#N)/N=N/C(C)(C#N)CC |
| InChI | InChI=1S/C10H16N4/c1-4-6-9(7-11)13-14-10(3,5-2)8-12/h9H,4-6H2,1-3H3/b14-13+ |
| InChIKey | VMGCAMCDQKOSKB-BUHFOSPRSA-N |
| XLogP | 2.82 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|