C22H20N2O3 — CID 123821836
(5-isocyano-1,3-oxazol-2-yl)-(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methanol (PubChem CID 123821836) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (5-isocyano-1,3-oxazol-2-yl)-(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methanol.
| Compound Name | (5-isocyano-1,3-oxazol-2-yl)-(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 123821836 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (5-isocyano-1,3-oxazol-2-yl)-(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methanol |
| SMILES | [C-]#[N+]c1cnc(C(O)C2CCc3cc(OCc4ccccc4)ccc3C2)o1 |
| InChI | InChI=1S/C22H20N2O3/c1-23-20-13-24-22(27-20)21(25)18-8-7-17-12-19(10-9-16(17)11-18)26-14-15-5-3-2-4-6-15/h2-6,9-10,12-13,18,21,25H,7-8,11,14H2 |
| InChIKey | TXFKOTGSEPNFAJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|