C14H24N2 — CID 123821977
2-[1-(ethylideneamino)hepta-2,6-dien-2-yl]-N,3-dimethylcyclopropan-1-amine (PubChem CID 123821977) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-[1-(ethylideneamino)hepta-2,6-dien-2-yl]-N,3-dimethylcyclopropan-1-amine.
| Compound Name | 2-[1-(ethylideneamino)hepta-2,6-dien-2-yl]-N,3-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 123821977 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-[1-(ethylideneamino)hepta-2,6-dien-2-yl]-N,3-dimethylcyclopropan-1-amine |
| SMILES | C=CCCC=C(C/N=C/C)C1C(C)C1NC |
| InChI | InChI=1S/C14H24N2/c1-5-7-8-9-12(10-16-6-2)13-11(3)14(13)15-4/h5-6,9,11,13-15H,1,7-8,10H2,2-4H3/b12-9?,16-6+ |
| InChIKey | MLDABQZEEKRPAN-UFOYLXRNSA-N |
| XLogP | 2.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|