C20H18N3O2S+ — CID 123823513
3-[2-[4-(cyclopropylamino)-3-methylthieno[3,2-d]pyrimidin-3-ium-7-yl]ethynyl]-4-methylbenzoic acid (PubChem CID 123823513) has the molecular formula C20H18N3O2S+ and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[2-[4-(cyclopropylamino)-3-methylthieno[3,2-d]pyrimidin-3-ium-7-yl]ethynyl]-4-methylbenzoic acid.
| Compound Name | 3-[2-[4-(cyclopropylamino)-3-methylthieno[3,2-d]pyrimidin-3-ium-7-yl]ethynyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 123823513 |
| Molecular Formula | C20H18N3O2S+ |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[2-[4-(cyclopropylamino)-3-methylthieno[3,2-d]pyrimidin-3-ium-7-yl]ethynyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C#Cc1csc2c(NC3CC3)[n+](C)cnc12 |
| InChI | InChI=1S/C20H17N3O2S/c1-12-3-4-14(20(24)25)9-13(12)5-6-15-10-26-18-17(15)21-11-23(2)19(18)22-16-7-8-16/h3-4,9-11,16H,7-8H2,1-2H3,(H,24,25)/p+1 |
| InChIKey | AVQZGHWEAKNTQR-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|