C26H20F3N5OS — CID 130182559
3-amino-N-[3-[2-[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylphenyl]-5-(trifluoromethyl)benzamide (PubChem CID 130182559) has the molecular formula C26H20F3N5OS and a molecular weight of 507.54 g/mol. Its IUPAC name is 3-amino-N-[3-[2-[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylphenyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-amino-N-[3-[2-[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylphenyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130182559 |
| Molecular Formula | C26H20F3N5OS |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 3-amino-N-[3-[2-[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylphenyl]-5-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(N)cc(C(F)(F)F)c2)cc1C#Cc1csc2c(NC3CC3)ncnc12 |
| InChI | InChI=1S/C26H20F3N5OS/c1-14-2-5-21(34-25(35)17-8-18(26(27,28)29)11-19(30)9-17)10-15(14)3-4-16-12-36-23-22(16)31-13-32-24(23)33-20-6-7-20/h2,5,8-13,20H,6-7,30H2,1H3,(H,34,35)(H,31,32,33) |
| InChIKey | ZROOCFDAVIDOBA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|