C27H25N3O3S — CID 71076419
ethyl 3-[2-[4-(3-methoxy-4,5-dimethylanilino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylbenzoate (PubChem CID 71076419) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is ethyl 3-[2-[4-(3-methoxy-4,5-dimethylanilino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylbenzoate.
| Compound Name | ethyl 3-[2-[4-(3-methoxy-4,5-dimethylanilino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 71076419 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | ethyl 3-[2-[4-(3-methoxy-4,5-dimethylanilino)thieno[3,2-d]pyrimidin-7-yl]ethynyl]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(C#Cc2csc3c(Nc4cc(C)c(C)c(OC)c4)ncnc23)c1 |
| InChI | InChI=1S/C27H25N3O3S/c1-6-33-27(31)20-8-7-16(2)19(12-20)9-10-21-14-34-25-24(21)28-15-29-26(25)30-22-11-17(3)18(4)23(13-22)32-5/h7-8,11-15H,6H2,1-5H3,(H,28,29,30) |
| InChIKey | RDPITQSSCWBNFY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|