C14H24O2 — CID 123825938
4-(methoxymethyl)-4-(5-methylhexa-2,4-dien-2-yl)oxane (PubChem CID 123825938) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4-(methoxymethyl)-4-(5-methylhexa-2,4-dien-2-yl)oxane.
| Compound Name | 4-(methoxymethyl)-4-(5-methylhexa-2,4-dien-2-yl)oxane |
|---|---|
| PubChem CID | 123825938 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4-(methoxymethyl)-4-(5-methylhexa-2,4-dien-2-yl)oxane |
| SMILES | COCC1(C(C)=CC=C(C)C)CCOCC1 |
| InChI | InChI=1S/C14H24O2/c1-12(2)5-6-13(3)14(11-15-4)7-9-16-10-8-14/h5-6H,7-11H2,1-4H3 |
| InChIKey | DPQBZDWYEKCYRC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|