C11H16O — CID 145099814
3-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methyloxolane (PubChem CID 145099814) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methyloxolane.
| Compound Name | 3-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methyloxolane |
|---|---|
| PubChem CID | 145099814 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 3-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methyloxolane |
| SMILES | C=C/C=C\C(=C)C1(C)CCOC1 |
| InChI | InChI=1S/C11H16O/c1-4-5-6-10(2)11(3)7-8-12-9-11/h4-6H,1-2,7-9H2,3H3/b6-5- |
| InChIKey | SECRQPCYWZPCBN-WAYWQWQTSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|