C13H22O — CID 134969003
(2R,3R)-2-tert-butyl-3-[(1E)-2-methylbuta-1,3-dienyl]oxolane (PubChem CID 134969003) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (2R,3R)-2-tert-butyl-3-[(1E)-2-methylbuta-1,3-dienyl]oxolane.
| Compound Name | (2R,3R)-2-tert-butyl-3-[(1E)-2-methylbuta-1,3-dienyl]oxolane |
|---|---|
| PubChem CID | 134969003 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (2R,3R)-2-tert-butyl-3-[(1E)-2-methylbuta-1,3-dienyl]oxolane |
| SMILES | C=C/C(C)=C/[C@H]1CCO[C@H]1C(C)(C)C |
| InChI | InChI=1S/C13H22O/c1-6-10(2)9-11-7-8-14-12(11)13(3,4)5/h6,9,11-12H,1,7-8H2,2-5H3/b10-9+/t11-,12-/m1/s1 |
| InChIKey | FZJVXAFRJZPNOF-CZHKVUGUSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|