C17H26O — CID 11817460
(3S,3aS,6aS)-4-ethenyl-6,6-dimethyl-3-(4-methylpent-4-enyl)-2,3,3a,6a-tetrahydrocyclopenta[b]furan (PubChem CID 11817460) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (3S,3aS,6aS)-4-ethenyl-6,6-dimethyl-3-(4-methylpent-4-enyl)-2,3,3a,6a-tetrahydrocyclopenta[b]furan.
| Compound Name | (3S,3aS,6aS)-4-ethenyl-6,6-dimethyl-3-(4-methylpent-4-enyl)-2,3,3a,6a-tetrahydrocyclopenta[b]furan |
|---|---|
| PubChem CID | 11817460 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3S,3aS,6aS)-4-ethenyl-6,6-dimethyl-3-(4-methylpent-4-enyl)-2,3,3a,6a-tetrahydrocyclopenta[b]furan |
| SMILES | C=CC1=CC(C)(C)[C@H]2OC[C@@H](CCCC(=C)C)[C@@H]12 |
| InChI | InChI=1S/C17H26O/c1-6-13-10-17(4,5)16-15(13)14(11-18-16)9-7-8-12(2)3/h6,10,14-16H,1-2,7-9,11H2,3-5H3/t14-,15-,16+/m1/s1 |
| InChIKey | UKCFHBGYAYWNHT-OAGGEKHMSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|