C35H35F5O8S2 — CID 123832377
[1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate (PubChem CID 123832377) has the molecular formula C35H35F5O8S2 and a molecular weight of 742.78 g/mol. Its IUPAC name is [1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate.
| Compound Name | [1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 123832377 |
| Molecular Formula | C35H35F5O8S2 |
| Molecular Weight | 742.78 g/mol |
| Exact Mass | 742.17 |
| IUPAC Name | [1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate |
| SMILES | CC(=O)C(=O)OC12CC3CC(C1)CC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C35H35F5O8S2/c1-23(41)29(42)48-33-20-24-17-25(21-33)19-32(18-24,22-33)31(43)47-30(34(36,37)38)35(39,40)50(44,45,46)49(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-16,24-25,30H,17-22H2,1H3,(H2,44,45,46) |
| InChIKey | GDJPQKHUVOGIJV-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.78 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|