C18H22N6O2S — CID 123833797
4-[(dimethylamino)methyl]-3-[[6-(methylamino)quinazolin-4-yl]amino]benzenesulfonamide (PubChem CID 123833797) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-3-[[6-(methylamino)quinazolin-4-yl]amino]benzenesulfonamide.
| Compound Name | 4-[(dimethylamino)methyl]-3-[[6-(methylamino)quinazolin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 123833797 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-[(dimethylamino)methyl]-3-[[6-(methylamino)quinazolin-4-yl]amino]benzenesulfonamide |
| SMILES | CNc1ccc2ncnc(Nc3cc(S(N)(=O)=O)ccc3CN(C)C)c2c1 |
| InChI | InChI=1S/C18H22N6O2S/c1-20-13-5-7-16-15(8-13)18(22-11-21-16)23-17-9-14(27(19,25)26)6-4-12(17)10-24(2)3/h4-9,11,20H,10H2,1-3H3,(H2,19,25,26)(H,21,22,23) |
| InChIKey | DCHHSKQMORERFL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |