C18H17ClF2N4O — CID 142342889
2-chloro-2-fluoroacetaldehyde;4-N-(4-fluoro-3-methylphenyl)-6-N-methylquinazoline-4,6-diamine (PubChem CID 142342889) has the molecular formula C18H17ClF2N4O and a molecular weight of 378.81 g/mol. Its IUPAC name is 2-chloro-2-fluoroacetaldehyde;4-N-(4-fluoro-3-methylphenyl)-6-N-methylquinazoline-4,6-diamine.
| Compound Name | 2-chloro-2-fluoroacetaldehyde;4-N-(4-fluoro-3-methylphenyl)-6-N-methylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 142342889 |
| Molecular Formula | C18H17ClF2N4O |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-chloro-2-fluoroacetaldehyde;4-N-(4-fluoro-3-methylphenyl)-6-N-methylquinazoline-4,6-diamine |
| SMILES | CNc1ccc2ncnc(Nc3ccc(F)c(C)c3)c2c1.O=CC(F)Cl |
| InChI | InChI=1S/C16H15FN4.C2H2ClFO/c1-10-7-12(3-5-14(10)17)21-16-13-8-11(18-2)4-6-15(13)19-9-20-16;3-2(4)1-5/h3-9,18H,1-2H3,(H,19,20,21);1-2H |
| InChIKey | ZSTQCZVVPYEONL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|