C22H31N — CID 123833977
N-cyclohexa-2,4-dien-1-yl-N-(7,7-dimethylocta-2,4-dien-3-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 123833977) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-(7,7-dimethylocta-2,4-dien-3-yl)cyclohexa-1,3-dien-1-amine.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-(7,7-dimethylocta-2,4-dien-3-yl)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 123833977 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-(7,7-dimethylocta-2,4-dien-3-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | CC=C(C=CCC(C)(C)C)N(C1=CC=CCC1)C1C=CC=CC1 |
| InChI | InChI=1S/C22H31N/c1-5-19(17-12-18-22(2,3)4)23(20-13-8-6-9-14-20)21-15-10-7-11-16-21/h5-10,12-13,15,17,20H,11,14,16,18H2,1-4H3 |
| InChIKey | HKTUZLWZUKVTEC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|