C6H20O3SSi3 — CID 123836993
3,3,3-tris(methoxysilyl)propane-1-thiol (PubChem CID 123836993) has the molecular formula C6H20O3SSi3 and a molecular weight of 256.55 g/mol. Its IUPAC name is 3,3,3-tris(methoxysilyl)propane-1-thiol.
| Compound Name | 3,3,3-tris(methoxysilyl)propane-1-thiol |
|---|---|
| PubChem CID | 123836993 |
| Molecular Formula | C6H20O3SSi3 |
| Molecular Weight | 256.55 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3,3,3-tris(methoxysilyl)propane-1-thiol |
| SMILES | CO[SiH2]C(CCS)([SiH2]OC)[SiH2]OC |
| InChI | InChI=1S/C6H20O3SSi3/c1-7-11-6(4-5-10,12-8-2)13-9-3/h10H,4-5,11-13H2,1-3H3 |
| InChIKey | HIOYDZDAAVTAGF-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.55 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|