C8H30O6Si6 — CID 123767373
methoxy-[1,1,2,2,2-pentakis(methoxysilyl)ethyl]silane (PubChem CID 123767373) has the molecular formula C8H30O6Si6 and a molecular weight of 390.84 g/mol. Its IUPAC name is methoxy-[1,1,2,2,2-pentakis(methoxysilyl)ethyl]silane.
| Compound Name | methoxy-[1,1,2,2,2-pentakis(methoxysilyl)ethyl]silane |
|---|---|
| PubChem CID | 123767373 |
| Molecular Formula | C8H30O6Si6 |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methoxy-[1,1,2,2,2-pentakis(methoxysilyl)ethyl]silane |
| SMILES | CO[SiH2]C([SiH2]OC)([SiH2]OC)C([SiH2]OC)([SiH2]OC)[SiH2]OC |
| InChI | InChI=1S/C8H30O6Si6/c1-9-15-7(16-10-2,17-11-3)8(18-12-4,19-13-5)20-14-6/h15-20H2,1-6H3 |
| InChIKey | FPXYAJLKYZVOOR-UHFFFAOYSA-N |
| XLogP | -4.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|