C30H40NO2S+ — CID 123837605
10-butyl-6,7-diethyl-7-(4-methoxypent-2-en-2-yloxymethyl)-6H-[1]benzothiolo[2,3-a]quinolizin-5-ium (PubChem CID 123837605) has the molecular formula C30H40NO2S+ and a molecular weight of 478.72 g/mol. Its IUPAC name is 10-butyl-6,7-diethyl-7-(4-methoxypent-2-en-2-yloxymethyl)-6H-[1]benzothiolo[2,3-a]quinolizin-5-ium.
| Compound Name | 10-butyl-6,7-diethyl-7-(4-methoxypent-2-en-2-yloxymethyl)-6H-[1]benzothiolo[2,3-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123837605 |
| Molecular Formula | C30H40NO2S+ |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 10-butyl-6,7-diethyl-7-(4-methoxypent-2-en-2-yloxymethyl)-6H-[1]benzothiolo[2,3-a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c3c(sc2c1)-c1cccc[n+]1C(CC)C3(CC)COC(C)=CC(C)OC |
| InChI | InChI=1S/C30H40NO2S/c1-7-10-13-23-15-16-24-26(19-23)34-29-25-14-11-12-17-31(25)27(8-2)30(9-3,28(24)29)20-33-22(5)18-21(4)32-6/h11-12,14-19,21,27H,7-10,13,20H2,1-6H3/q+1 |
| InChIKey | LQERVPSXOHWUSL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|