C27H29N — CID 123837691
8-tert-butyl-1-cyclohexa-1,3-dien-1-yl-4,4a,6a,10a-tetrahydronaphtho[2,1-f]isoquinoline (PubChem CID 123837691) has the molecular formula C27H29N and a molecular weight of 367.54 g/mol. Its IUPAC name is 8-tert-butyl-1-cyclohexa-1,3-dien-1-yl-4,4a,6a,10a-tetrahydronaphtho[2,1-f]isoquinoline.
| Compound Name | 8-tert-butyl-1-cyclohexa-1,3-dien-1-yl-4,4a,6a,10a-tetrahydronaphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 123837691 |
| Molecular Formula | C27H29N |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 8-tert-butyl-1-cyclohexa-1,3-dien-1-yl-4,4a,6a,10a-tetrahydronaphtho[2,1-f]isoquinoline |
| SMILES | CC(C)(C)C1=CC2C=CC3=C(C=CC4=C(C5=CC=CCC5)N=CCC43)C2C=C1 |
| InChI | InChI=1S/C27H29N/c1-27(2,3)20-10-12-21-19(17-20)9-11-23-22(21)13-14-25-24(23)15-16-28-26(25)18-7-5-4-6-8-18/h4-5,7,9-14,16-17,19,21,24H,6,8,15H2,1-3H3 |
| InChIKey | IMFAYNNIAQDSTL-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |