C20H27Cl2N3O — CID 123838219
1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-ethylidenepent-3-enyl)-3-methylpyrrolidin-3-yl]urea (PubChem CID 123838219) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-ethylidenepent-3-enyl)-3-methylpyrrolidin-3-yl]urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-ethylidenepent-3-enyl)-3-methylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 123838219 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-ethylidenepent-3-enyl)-3-methylpyrrolidin-3-yl]urea |
| SMILES | CC=CC(=CC)CN1CCC(C)(NC(=O)NCc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H27Cl2N3O/c1-4-6-15(5-2)13-25-10-9-20(3,14-25)24-19(26)23-12-16-7-8-17(21)18(22)11-16/h4-8,11H,9-10,12-14H2,1-3H3,(H2,23,24,26) |
| InChIKey | DSDGXKXKRZAEAA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|