C24H35Cl2N3O2 — CID 123380702
3-[(3,4-dichlorophenyl)methyl]-1-[1-(2-ethylidenepent-3-enyl)piperidin-4-yl]-1-(3-methoxypropyl)urea (PubChem CID 123380702) has the molecular formula C24H35Cl2N3O2 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-1-[1-(2-ethylidenepent-3-enyl)piperidin-4-yl]-1-(3-methoxypropyl)urea.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-1-[1-(2-ethylidenepent-3-enyl)piperidin-4-yl]-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 123380702 |
| Molecular Formula | C24H35Cl2N3O2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-1-[1-(2-ethylidenepent-3-enyl)piperidin-4-yl]-1-(3-methoxypropyl)urea |
| SMILES | CC=CC(=CC)CN1CCC(N(CCCOC)C(=O)NCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C24H35Cl2N3O2/c1-4-7-19(5-2)18-28-13-10-21(11-14-28)29(12-6-15-31-3)24(30)27-17-20-8-9-22(25)23(26)16-20/h4-5,7-9,16,21H,6,10-15,17-18H2,1-3H3,(H,27,30) |
| InChIKey | PHSJZOXESAQEJD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|