C20H25Cl2N3O — CID 123993089
N-[(3,4-dichlorophenyl)methyl]-4-(2-methylidenehepta-3,5-dienyl)piperazine-1-carboxamide (PubChem CID 123993089) has the molecular formula C20H25Cl2N3O and a molecular weight of 394.35 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-4-(2-methylidenehepta-3,5-dienyl)piperazine-1-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-4-(2-methylidenehepta-3,5-dienyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 123993089 |
| Molecular Formula | C20H25Cl2N3O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-4-(2-methylidenehepta-3,5-dienyl)piperazine-1-carboxamide |
| SMILES | C=C(C=CC=CC)CN1CCN(C(=O)NCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H25Cl2N3O/c1-3-4-5-6-16(2)15-24-9-11-25(12-10-24)20(26)23-14-17-7-8-18(21)19(22)13-17/h3-8,13H,2,9-12,14-15H2,1H3,(H,23,26) |
| InChIKey | NVRHKDHIQKHERJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|