C8H13F2N — CID 123839091
(4,6-difluorocyclohepten-1-yl)methanamine (PubChem CID 123839091) has the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. Its IUPAC name is (4,6-difluorocyclohepten-1-yl)methanamine.
| Compound Name | (4,6-difluorocyclohepten-1-yl)methanamine |
|---|---|
| PubChem CID | 123839091 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (4,6-difluorocyclohepten-1-yl)methanamine |
| SMILES | NCC1=CCC(F)CC(F)C1 |
| InChI | InChI=1S/C8H13F2N/c9-7-2-1-6(5-11)3-8(10)4-7/h1,7-8H,2-5,11H2 |
| InChIKey | LGVLFZTXZYCPNV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|