C8H17F3N2O2S — CID 123840797
N-(3-aminopentyl)-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 123840797) has the molecular formula C8H17F3N2O2S and a molecular weight of 262.30 g/mol. Its IUPAC name is N-(3-aminopentyl)-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | N-(3-aminopentyl)-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 123840797 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-(3-aminopentyl)-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CCC(N)CCNS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O2S/c1-2-7(12)3-5-13-16(14,15)6-4-8(9,10)11/h7,13H,2-6,12H2,1H3 |
| InChIKey | XOJJXJDNLDSUDX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |