C9H19F3N2OS — CID 162576160
N-(3,3,3-trifluoropropylsulfonimidoyl)hexan-2-amine (PubChem CID 162576160) has the molecular formula C9H19F3N2OS and a molecular weight of 260.32 g/mol. Its IUPAC name is N-(3,3,3-trifluoropropylsulfonimidoyl)hexan-2-amine.
| Compound Name | N-(3,3,3-trifluoropropylsulfonimidoyl)hexan-2-amine |
|---|---|
| PubChem CID | 162576160 |
| Molecular Formula | C9H19F3N2OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-(3,3,3-trifluoropropylsulfonimidoyl)hexan-2-amine |
| SMILES | [H]N=S(=O)(CCC(F)(F)F)NC(C)CCCC |
| InChI | InChI=1S/C9H19F3N2OS/c1-3-4-5-8(2)14-16(13,15)7-6-9(10,11)12/h8H,3-7H2,1-2H3,(H2,13,14,15) |
| InChIKey | MRWCAFMBNDYVAI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |