C16H25FN2O4 — CID 123842508
4-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-N-(3-ethoxybut-2-en-2-yl)-2-fluorobut-2-enamide (PubChem CID 123842508) has the molecular formula C16H25FN2O4 and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-N-(3-ethoxybut-2-en-2-yl)-2-fluorobut-2-enamide.
| Compound Name | 4-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-N-(3-ethoxybut-2-en-2-yl)-2-fluorobut-2-enamide |
|---|---|
| PubChem CID | 123842508 |
| Molecular Formula | C16H25FN2O4 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-N-(3-ethoxybut-2-en-2-yl)-2-fluorobut-2-enamide |
| SMILES | CCOC(C)=C(C)NC(=O)C(F)=CCN1CC2OCCOC2C1 |
| InChI | InChI=1S/C16H25FN2O4/c1-4-21-12(3)11(2)18-16(20)13(17)5-6-19-9-14-15(10-19)23-8-7-22-14/h5,14-15H,4,6-10H2,1-3H3,(H,18,20) |
| InChIKey | PAHCYKSGLAZEBQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|