C7H13NO2 — CID 123843316
N-(3-methyloxiran-2-yl)butanamide (PubChem CID 123843316) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is N-(3-methyloxiran-2-yl)butanamide.
| Compound Name | N-(3-methyloxiran-2-yl)butanamide |
|---|---|
| PubChem CID | 123843316 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-(3-methyloxiran-2-yl)butanamide |
| SMILES | CCCC(=O)NC1OC1C |
| InChI | InChI=1S/C7H13NO2/c1-3-4-6(9)8-7-5(2)10-7/h5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | ZCZAUMZETSVKMP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|